| 2-(Aminomethyl)-1-ethylpyrrolidine Basic information |
| Product Name: | 2-(Aminomethyl)-1-ethylpyrrolidine |
| Synonyms: | (1-Ethyl-2-pyrrolidinyl)methanamine;1-Ethyl-2-(aminomethyl)pyrrolidine;1-Ethyl-2-pyrrolidinemethylamine;2-(Aminomethyl)-N-ethylpyrrolidine;AMisulpride IMpurity A (Sulpiride IMpurity A);Sulpiride IMpurity A (AMisulpride IMpurity A);Pyrrolidine, 2-(aminomethyl)-1-ethyl-;2-(Aminomethyl)-1-ethylpyrrolidine 97% |
| CAS: | 26116-12-1 |
| MF: | C7H16N2 |
| MW: | 128.22 |
| EINECS: | 247-466-3 |
| Product Categories: | Piperidines;API intermediates;Building Blocks;Heterocyclic Building Blocks;Pyrrolidines |
| Mol File: | 26116-12-1.mol |
| 2-(Aminomethyl)-1-ethylpyrrolidine Chemical Properties |
| Boiling point | 58-60 °C16 mm Hg(lit.) |
| density | 0.884 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 135 °F |
| storage temp. | 2-8°C |
| pka | 10.04±0.40(Predicted) |
| form | Liquid |
| color | Clear yellow |
| InChI | InChI=1S/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3 |
| InChIKey | UNRBEYYLYRXYCG-UHFFFAOYSA-N |
| SMILES | N1(CC)CCCC1CN |
| CAS DataBase Reference | 26116-12-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pyrrolidinemethanamine, 1-ethyl-(26116-12-1) |
| Safety Information |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29339900 |
| MSDS Information |
| Provider | Language |
|---|---|
| 1-Ethylpyrrolidin-2-ylmethylamine | English |
| SigmaAldrich | English |
| ACROS | English |
| 2-(Aminomethyl)-1-ethylpyrrolidine Usage And Synthesis |
| Chemical Properties | clear yellow liquid |
| 2-(Aminomethyl)-1-ethylpyrrolidine Preparation Products And Raw materials |
| Raw materials | N,N-Dimethylformamide-->Tetrahydrofurfuryl alcohol |
| Preparation Products | Levosulpiride-->Remoxipride-->AMisulpride IMpurity D |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.