| 2,6-Dichloro-3-fluoroacetophenone Basic information |
| Product Name: | 2,6-Dichloro-3-fluoroacetophenone |
| Synonyms: | 2,6-DICHLORO-5-FLUORO ACETOPHENONE;2',6'-DICHLORO-3'-FLUOROACETOPHENONE;2,6-DICHLORO-3-FLUOROACETOPHENONE;2',6'-Dichloro-3'-Fluoroacetophenone 3-Fluoro-2,6-Dichloroacetophenone;2,6-dichloro-3-fluro acetophenone;2',6'-DICHLORO-3'-FLUOROACETOPHENONE, 98;2',6'-Dichloro-3'-fluoroacetophenone 98%;3-Fluoro-2,6-Dichloroacetophenone |
| CAS: | 290835-85-7 |
| MF: | C8H5Cl2FO |
| MW: | 207.03 |
| EINECS: | |
| Product Categories: | C7 to C8;Carbonyl Compounds;Carbonyl Compounds;Ketones;bc0001 |
| Mol File: | 290835-85-7.mol |
| 2,6-Dichloro-3-fluoroacetophenone Chemical Properties |
| Boiling point | 255 °C(lit.) |
| density | 1.403 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 255°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.403 |
| color | Clear colorless to light yellow |
| InChI | InChI=1S/C8H5Cl2FO/c1-4(12)7-5(9)2-3-6(11)8(7)10/h2-3H,1H3 |
| InChIKey | VJBFZHHRVCPAPZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=C(Cl)C=CC(F)=C1Cl)C |
| CAS DataBase Reference | 290835-85-7(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | Xi,F,T |
| Risk Statements | 36/37/38-22-25 |
| Safety Statements | 37/39-26-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29143990 |
| MSDS Information |
| Provider | Language |
|---|---|
| SigmaAldrich | English |
| ACROS | English |
| 2,6-Dichloro-3-fluoroacetophenone Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liqui |
| Uses | 2,6-Dichloro-3-fluoroacetophenone is a halogenated derivative of Acetophenone (A164015), a reagent used in the production of fragrances and resin polymers. |
| Uses | 2′,6′-Dichloro-3′-fluoroacetophenone (2,6-Dichloro-3-fluoroacetophenone) may be used to synthesize the enantiomerically pure form of (S)-1-(2,6-dichloro-3-fluorophenyl)ethanol. |
| General Description | 2′,6′-Dichloro-3′-fluoroacetophenone is an aryl fluorinated building block. |
| 2,6-Dichloro-3-fluoroacetophenone Preparation Products And Raw materials |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.
日本语
한국어
Français
Deutsch
España
Türkiye